C23H23N3O3 — CID 121162565
[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(4-phenoxyphenyl)methanone (PubChem CID 121162565) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is [4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(4-phenoxyphenyl)methanone.
| Compound Name | [4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 121162565 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-(4-phenoxyphenyl)methanone |
| SMILES | Cc1nccc(OC2CCN(C(=O)c3ccc(Oc4ccccc4)cc3)CC2)n1 |
| InChI | InChI=1S/C23H23N3O3/c1-17-24-14-11-22(25-17)29-21-12-15-26(16-13-21)23(27)18-7-9-20(10-8-18)28-19-5-3-2-4-6-19/h2-11,14,21H,12-13,15-16H2,1H3 |
| InChIKey | FUFXFCJQYDBTNZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |