C16H19N5O3 — CID 121162619
2-[2-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-oxoethyl]pyridazin-3-one (PubChem CID 121162619) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[2-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-oxoethyl]pyridazin-3-one.
| Compound Name | 2-[2-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 121162619 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-[2-[4-(2-methylpyrimidin-4-yl)oxypiperidin-1-yl]-2-oxoethyl]pyridazin-3-one |
| SMILES | Cc1nccc(OC2CCN(C(=O)Cn3ncccc3=O)CC2)n1 |
| InChI | InChI=1S/C16H19N5O3/c1-12-17-8-4-14(19-12)24-13-5-9-20(10-6-13)16(23)11-21-15(22)3-2-7-18-21/h2-4,7-8,13H,5-6,9-11H2,1H3 |
| InChIKey | FHINEFGZJORJOQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |