ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate

C17H15NO4 — CID 10447326

IUPACethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate
SMILESCCOC(=O)COc1ccc2cc(-c3ncco3)ccc2c1
InChIInChI=1S/C17H15NO4/c1-2-20-16(19)11-22-15-6-5-12-9-14(4-3-13(12)10-15)17-18-7-8-21-17/h3-10H,2,11H2,1H3
InChIKeyJBMDGSSCSJCRIT-UHFFFAOYSA-N
MW297.31 g/mol
LogP3.44
Rot. Bonds5

About ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate

ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate (PubChem CID 10447326) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate.

Molecular Properties

Compound Nameethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate
PubChem CID10447326
Molecular FormulaC17H15NO4
Molecular Weight297.31 g/mol
Exact Mass297.10
IUPAC Nameethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate
SMILESCCOC(=O)COc1ccc2cc(-c3ncco3)ccc2c1
InChIInChI=1S/C17H15NO4/c1-2-20-16(19)11-22-15-6-5-12-9-14(4-3-13(12)10-15)17-18-7-8-21-17/h3-10H,2,11H2,1H3
InChIKeyJBMDGSSCSJCRIT-UHFFFAOYSA-N
XLogP3.44
TPSA61.56 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.31
LogP ≤ 53.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate?
The IUPAC name of ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate (CID 10447326) is ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate.
What is the SMILES notation for ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate?
The canonical SMILES for ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate is CCOC(=O)COc1ccc2cc(-c3ncco3)ccc2c1.
What is the InChIKey of ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate?
The InChIKey is JBMDGSSCSJCRIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-2-20-16(19)11-22-15-6-5-12-9-14(4-3-13(12)10-15)17-18-7-8-21-17/h3-10H,2,11H2,1H3.
What are the key properties of ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate?
ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate has a molecular weight of 297.31 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[6-(1,3-oxazol-2-yl)naphthalen-2-yl]oxyacetate is sourced from PubChem (CID 10447326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).