C27H25NO4 — CID 10002638
ethyl 2-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]acetate (PubChem CID 10002638) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl 2-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 10002638 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | ethyl 2-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2nc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C27H25NO4/c1-4-30-24(29)17-31-23-15-13-22(14-16-23)27-28-25(20-9-5-18(2)6-10-20)26(32-27)21-11-7-19(3)8-12-21/h5-16H,4,17H2,1-3H3 |
| InChIKey | CNTFHIIUSVSZNN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |