C29H29NO4 — CID 10343994
6-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]hexanoic acid (PubChem CID 10343994) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is 6-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]hexanoic acid.
| Compound Name | 6-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 10343994 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 6-[4-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]phenoxy]hexanoic acid |
| SMILES | Cc1ccc(-c2nc(-c3ccc(OCCCCCC(=O)O)cc3)oc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H29NO4/c1-20-7-11-22(12-8-20)27-28(23-13-9-21(2)10-14-23)34-29(30-27)24-15-17-25(18-16-24)33-19-5-3-4-6-26(31)32/h7-18H,3-6,19H2,1-2H3,(H,31,32) |
| InChIKey | WMNDQIQSDXVJRU-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|