C19H19N3O3 — CID 58533133
ethyl 2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]acetate (PubChem CID 58533133) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl 2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]acetate.
| Compound Name | ethyl 2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]acetate |
|---|---|
| PubChem CID | 58533133 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | ethyl 2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(-c2ccc(N)cc2)c(-c2ccc(N)cc2)o1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-24-17(23)11-16-22-18(12-3-7-14(20)8-4-12)19(25-16)13-5-9-15(21)10-6-13/h3-10H,2,11,20-21H2,1H3 |
| InChIKey | HQJRJNQTFFQZOV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|