C22H22N2O4 — CID 91284514
ethyl 2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)prop-1-enylamino]oxyacetate (PubChem CID 91284514) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)prop-1-enylamino]oxyacetate.
| Compound Name | ethyl 2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)prop-1-enylamino]oxyacetate |
|---|---|
| PubChem CID | 91284514 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl 2-[3-(4,5-diphenyl-1,3-oxazol-2-yl)prop-1-enylamino]oxyacetate |
| SMILES | CCOC(=O)CONC=CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H22N2O4/c1-2-26-20(25)16-27-23-15-9-14-19-24-21(17-10-5-3-6-11-17)22(28-19)18-12-7-4-8-13-18/h3-13,15,23H,2,14,16H2,1H3 |
| InChIKey | ZKYRHEGTRYLDKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|