C24H19N2NaO4 — CID 135932192
sodium 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate (PubChem CID 135932192) has the molecular formula C24H19N2NaO4 and a molecular weight of 422.42 g/mol. Its IUPAC name is sodium 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate.
| Compound Name | sodium 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate |
|---|---|
| PubChem CID | 135932192 |
| Molecular Formula | C24H19N2NaO4 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | sodium 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate |
| SMILES | O=C([O-])CCCOc1cc(-c2ccccc2)nc(-c2ccc3cc(O)ccc3c2)n1.[Na+] |
| InChI | InChI=1S/C24H20N2O4.Na/c27-20-11-10-17-13-19(9-8-18(17)14-20)24-25-21(16-5-2-1-3-6-16)15-22(26-24)30-12-4-7-23(28)29;/h1-3,5-6,8-11,13-15,27H,4,7,12H2,(H,28,29);/q;+1/p-1 |
| InChIKey | ZIPXYBDXOCDLFC-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|