C28H35NO5 — CID 100970143
6-[4-[6-[(2S)-2-methylbutoxy]-1,3-benzoxazol-2-yl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 100970143) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 6-[4-[6-[(2S)-2-methylbutoxy]-1,3-benzoxazol-2-yl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[6-[(2S)-2-methylbutoxy]-1,3-benzoxazol-2-yl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 100970143 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 6-[4-[6-[(2S)-2-methylbutoxy]-1,3-benzoxazol-2-yl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(-c2nc3ccc(OC[C@@H](C)CC)cc3o2)cc1 |
| InChI | InChI=1S/C28H35NO5/c1-5-21(4)19-33-24-14-15-25-26(18-24)34-27(29-25)22-10-12-23(13-11-22)31-16-8-6-7-9-17-32-28(30)20(2)3/h10-15,18,21H,2,5-9,16-17,19H2,1,3-4H3/t21-/m0/s1 |
| InChIKey | PHEAFAZIXHERRH-NRFANRHFSA-N |
| XLogP | 6.98 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|