C28H26N2O6 — CID 135973405
2-[5-[6-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid (PubChem CID 135973405) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-[5-[6-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid.
| Compound Name | 2-[5-[6-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid |
|---|---|
| PubChem CID | 135973405 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[5-[6-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid |
| SMILES | O=C(O)C(CCCCCOc1ccc2cc(-c3nc(-c4ccccc4)cc(=O)[nH]3)ccc2c1)C(=O)O |
| InChI | InChI=1S/C28H26N2O6/c31-25-17-24(18-7-3-1-4-8-18)29-26(30-25)21-11-10-20-16-22(13-12-19(20)15-21)36-14-6-2-5-9-23(27(32)33)28(34)35/h1,3-4,7-8,10-13,15-17,23H,2,5-6,9,14H2,(H,32,33)(H,34,35)(H,29,30,31) |
| InChIKey | TUUZZFQJVPSKIK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|