C19H16N2O4S — CID 136923110
2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid (PubChem CID 136923110) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 136923110 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(SCc3ccccc3C(=O)O)n2)cc1 |
| InChI | InChI=1S/C19H16N2O4S/c1-25-14-8-6-12(7-9-14)16-10-17(22)21-19(20-16)26-11-13-4-2-3-5-15(13)18(23)24/h2-10H,11H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | ALZSSSDIUHAVIE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |