C20H16N4O3S — CID 135413027
2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135413027) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135413027 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(SCc3nc4ccccc4c(=O)[nH]3)n2)cc1 |
| InChI | InChI=1S/C20H16N4O3S/c1-27-13-8-6-12(7-9-13)16-10-18(25)24-20(22-16)28-11-17-21-15-5-3-2-4-14(15)19(26)23-17/h2-10H,11H2,1H3,(H,21,23,26)(H,22,24,25) |
| InChIKey | OOQSPOQJSVITMM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |