C18H14N4OS — CID 135423688
2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-phenyl-1H-pyrimidin-6-one (PubChem CID 135423688) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135423688 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2)nc(SCc2nc3ccccc3[nH]2)[nH]1 |
| InChI | InChI=1S/C18H14N4OS/c23-17-10-15(12-6-2-1-3-7-12)21-18(22-17)24-11-16-19-13-8-4-5-9-14(13)20-16/h1-10H,11H2,(H,19,20)(H,21,22,23) |
| InChIKey | XDFKDQBQJDKUIM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |