C19H16N4O2S — CID 136687515
2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-(phenoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136687515) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-(phenoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-(phenoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136687515 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-4-(phenoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(COc2ccccc2)nc(SCc2nc3ccccc3[nH]2)[nH]1 |
| InChI | InChI=1S/C19H16N4O2S/c24-18-10-13(11-25-14-6-2-1-3-7-14)20-19(23-18)26-12-17-21-15-8-4-5-9-16(15)22-17/h1-10H,11-12H2,(H,21,22)(H,20,23,24) |
| InChIKey | PRQBENUGNUMSKI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |