C25H21N3O3S — CID 136687474
2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide (PubChem CID 136687474) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide.
| Compound Name | 2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 136687474 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide |
| SMILES | O=C(CSc1nc(COc2ccccc2)cc(=O)[nH]1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O3S/c29-23-16-19(17-31-22-14-8-3-9-15-22)26-25(27-23)32-18-24(30)28(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-16H,17-18H2,(H,26,27,29) |
| InChIKey | HKAOHWSSXSSWDU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |