C16H19N3O2S — CID 135445460
N-methyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-phenylacetamide (PubChem CID 135445460) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-methyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | N-methyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135445460 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-methyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-phenylacetamide |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C16H19N3O2S/c1-3-7-12-10-14(20)18-16(17-12)22-11-15(21)19(2)13-8-5-4-6-9-13/h4-6,8-10H,3,7,11H2,1-2H3,(H,17,18,20) |
| InChIKey | RADUSYYNNAECKV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |