C15H15BrN2O2S — CID 135910525
2-[2-(2-bromophenyl)-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one (PubChem CID 135910525) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2-bromophenyl)-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135910525 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-[2-(2-bromophenyl)-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)c2ccccc2Br)n1 |
| InChI | InChI=1S/C15H15BrN2O2S/c1-2-5-10-8-14(20)18-15(17-10)21-9-13(19)11-6-3-4-7-12(11)16/h3-4,6-8H,2,5,9H2,1H3,(H,17,18,20) |
| InChIKey | RPYDCHQGCYBSTJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |