C17H13ClN2OS — CID 135450344
2-[(4-chlorophenyl)methylsulfanyl]-4-phenyl-1H-pyrimidin-6-one (PubChem CID 135450344) has the molecular formula C17H13ClN2OS and a molecular weight of 328.82 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135450344 |
| Molecular Formula | C17H13ClN2OS |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-4-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2)nc(SCc2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C17H13ClN2OS/c18-14-8-6-12(7-9-14)11-22-17-19-15(10-16(21)20-17)13-4-2-1-3-5-13/h1-10H,11H2,(H,19,20,21) |
| InChIKey | QAKYDAURAWNPNG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |