C17H14ClN3O3S2 — CID 135463290
N-[2-[(4-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]benzenesulfonamide (PubChem CID 135463290) has the molecular formula C17H14ClN3O3S2 and a molecular weight of 407.90 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135463290 |
| Molecular Formula | C17H14ClN3O3S2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]benzenesulfonamide |
| SMILES | O=c1cc(NS(=O)(=O)c2ccccc2)nc(SCc2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C17H14ClN3O3S2/c18-13-8-6-12(7-9-13)11-25-17-19-15(10-16(22)20-17)21-26(23,24)14-4-2-1-3-5-14/h1-10H,11H2,(H2,19,20,21,22) |
| InChIKey | JLDONEFOBUEJOL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |