C13H9F3N2O3S — CID 136923123
2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid (PubChem CID 136923123) has the molecular formula C13H9F3N2O3S and a molecular weight of 330.29 g/mol. Its IUPAC name is 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 136923123 |
| Molecular Formula | C13H9F3N2O3S |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CSc1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H9F3N2O3S/c14-13(15,16)9-5-10(19)18-12(17-9)22-6-7-3-1-2-4-8(7)11(20)21/h1-5H,6H2,(H,20,21)(H,17,18,19) |
| InChIKey | PZGKBGYTUHWDHW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |