C13H11F3N2O2S — CID 136794905
2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136794905) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136794905 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(SCc2ccc(CO)cc2)[nH]1 |
| InChI | InChI=1S/C13H11F3N2O2S/c14-13(15,16)10-5-11(20)18-12(17-10)21-7-9-3-1-8(6-19)2-4-9/h1-5,19H,6-7H2,(H,17,18,20) |
| InChIKey | KZCYHSMNEMRZJS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |