C13H9F5N2O2S — CID 136706587
2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136706587) has the molecular formula C13H9F5N2O2S and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136706587 |
| Molecular Formula | C13H9F5N2O2S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(SCc2ccc(OC(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C13H9F5N2O2S/c14-11(15)22-8-3-1-7(2-4-8)6-23-12-19-9(13(16,17)18)5-10(21)20-12/h1-5,11H,6H2,(H,19,20,21) |
| InChIKey | TVZZCXJXZPWRRX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |