C12H8F3N3O2S — CID 146025397
2-(2-oxo-2-pyridin-3-ylethyl)sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 146025397) has the molecular formula C12H8F3N3O2S and a molecular weight of 315.28 g/mol. Its IUPAC name is 2-(2-oxo-2-pyridin-3-ylethyl)sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2-oxo-2-pyridin-3-ylethyl)sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146025397 |
| Molecular Formula | C12H8F3N3O2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(2-oxo-2-pyridin-3-ylethyl)sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=C(CSc1nc(C(F)(F)F)cc(=O)[nH]1)c1cccnc1 |
| InChI | InChI=1S/C12H8F3N3O2S/c13-12(14,15)9-4-10(20)18-11(17-9)21-6-8(19)7-2-1-3-16-5-7/h1-5H,6H2,(H,17,18,20) |
| InChIKey | MLLANPZSPFLQPZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |