C16H16F3N3O2S — CID 136797577
2-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136797577) has the molecular formula C16H16F3N3O2S and a molecular weight of 371.38 g/mol. Its IUPAC name is 2-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136797577 |
| Molecular Formula | C16H16F3N3O2S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | C=CCn1c(C)cc(C(=O)CSc2nc(C(F)(F)F)cc(=O)[nH]2)c1C |
| InChI | InChI=1S/C16H16F3N3O2S/c1-4-5-22-9(2)6-11(10(22)3)12(23)8-25-15-20-13(16(17,18)19)7-14(24)21-15/h4,6-7H,1,5,8H2,2-3H3,(H,20,21,24) |
| InChIKey | SZOQODUAOQLCSA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|