C25H23NO4S — CID 20539981
6-[4-(4-phenylphenyl)sulfonylbutoxy]-1H-quinolin-2-one (PubChem CID 20539981) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 6-[4-(4-phenylphenyl)sulfonylbutoxy]-1H-quinolin-2-one.
| Compound Name | 6-[4-(4-phenylphenyl)sulfonylbutoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20539981 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 6-[4-(4-phenylphenyl)sulfonylbutoxy]-1H-quinolin-2-one |
| SMILES | O=c1ccc2cc(OCCCCS(=O)(=O)c3ccc(-c4ccccc4)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C25H23NO4S/c27-25-15-10-21-18-22(11-14-24(21)26-25)30-16-4-5-17-31(28,29)23-12-8-20(9-13-23)19-6-2-1-3-7-19/h1-3,6-15,18H,4-5,16-17H2,(H,26,27) |
| InChIKey | GHKNAGUVTSHNMB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|