C21H21N5O2 — CID 23454021
6-[3-[1-(2-phenylethyl)tetrazol-5-yl]propoxy]-1H-quinolin-2-one (PubChem CID 23454021) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-[3-[1-(2-phenylethyl)tetrazol-5-yl]propoxy]-1H-quinolin-2-one.
| Compound Name | 6-[3-[1-(2-phenylethyl)tetrazol-5-yl]propoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 23454021 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 6-[3-[1-(2-phenylethyl)tetrazol-5-yl]propoxy]-1H-quinolin-2-one |
| SMILES | O=c1ccc2cc(OCCCc3nnnn3CCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C21H21N5O2/c27-21-11-8-17-15-18(9-10-19(17)22-21)28-14-4-7-20-23-24-25-26(20)13-12-16-5-2-1-3-6-16/h1-3,5-6,8-11,15H,4,7,12-14H2,(H,22,27) |
| InChIKey | HYIOULIKZLIPKZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|