C21H21NO6 — CID 165142376
3,5,7-trihydroxy-8-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one (PubChem CID 165142376) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3,5,7-trihydroxy-8-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one.
| Compound Name | 3,5,7-trihydroxy-8-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 165142376 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3,5,7-trihydroxy-8-methoxy-2-(4-piperidin-1-ylphenyl)chromen-4-one |
| SMILES | COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(N4CCCCC4)cc3)oc12 |
| InChI | InChI=1S/C21H21NO6/c1-27-20-15(24)11-14(23)16-17(25)18(26)19(28-21(16)20)12-5-7-13(8-6-12)22-9-3-2-4-10-22/h5-8,11,23-24,26H,2-4,9-10H2,1H3 |
| InChIKey | GXTWREAVDNUDQQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |