C17H14ClNO4 — CID 7730706
(NZ)-N-[6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]hydroxylamine (PubChem CID 7730706) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is (NZ)-N-[6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7730706 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (NZ)-N-[6-chloro-2-(3,4-dimethoxyphenyl)chromen-4-ylidene]hydroxylamine |
| SMILES | COc1ccc(-c2c/c(=N/O)c3cc(Cl)ccc3o2)cc1OC |
| InChI | InChI=1S/C17H14ClNO4/c1-21-15-5-3-10(7-17(15)22-2)16-9-13(19-20)12-8-11(18)4-6-14(12)23-16/h3-9,20H,1-2H3/b19-13- |
| InChIKey | YEILJBSFVJLSRS-UYRXBGFRSA-N |
| XLogP | 4.06 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|