About ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate
ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate (PubChem CID 19105287) has the molecular formula C20H17ClO6
and a molecular weight of 388.80 g/mol. Its IUPAC name is ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate |
| PubChem CID | 19105287 |
| Molecular Formula | C20H17ClO6 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)c2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C20H17ClO6/c1-4-26-19(22)18-17(11-5-7-15(24-2)16(9-11)25-3)13-10-12(21)6-8-14(13)27-20(18)23/h5-10H,4H2,1-3H3 |
| InChIKey | ANGVTRWWVCHICA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate?
The IUPAC name of ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate (CID 19105287) is ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate.
What is the SMILES notation for ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate?
The canonical SMILES for ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate is CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)c2cc(Cl)ccc2oc1=O.
What is the InChIKey of ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate?
The InChIKey is ANGVTRWWVCHICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClO6/c1-4-26-19(22)18-17(11-5-7-15(24-2)16(9-11)25-3)13-10-12(21)6-8-14(13)27-20(18)23/h5-10H,4H2,1-3H3.
What are the key properties of ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate?
ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate has a molecular weight of 388.80 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-chloro-4-(3,4-dimethoxyphenyl)-2-oxochromene-3-carboxylate is sourced from PubChem (CID 19105287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).