C21H21NO5 — CID 23736058
2-[[6-hydroxy-2-(4-methoxyphenyl)chromen-4-ylidene]amino]-3-methylbutanoic acid (PubChem CID 23736058) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[[6-hydroxy-2-(4-methoxyphenyl)chromen-4-ylidene]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[6-hydroxy-2-(4-methoxyphenyl)chromen-4-ylidene]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 23736058 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[[6-hydroxy-2-(4-methoxyphenyl)chromen-4-ylidene]amino]-3-methylbutanoic acid |
| SMILES | COc1ccc(-c2c/c(=N\C(C(=O)O)C(C)C)c3cc(O)ccc3o2)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-12(2)20(21(24)25)22-17-11-19(13-4-7-15(26-3)8-5-13)27-18-9-6-14(23)10-16(17)18/h4-12,20,23H,1-3H3,(H,24,25)/b22-17+ |
| InChIKey | IMJLBCNQXLZKIM-OQKWZONESA-N |
| XLogP | 3.82 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |