C23H16N2O3S — CID 20998308
(4E)-4-(1,3-benzothiazol-2-ylimino)-2-(4-methoxyphenyl)chromen-6-ol (PubChem CID 20998308) has the molecular formula C23H16N2O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is (4E)-4-(1,3-benzothiazol-2-ylimino)-2-(4-methoxyphenyl)chromen-6-ol.
| Compound Name | (4E)-4-(1,3-benzothiazol-2-ylimino)-2-(4-methoxyphenyl)chromen-6-ol |
|---|---|
| PubChem CID | 20998308 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (4E)-4-(1,3-benzothiazol-2-ylimino)-2-(4-methoxyphenyl)chromen-6-ol |
| SMILES | COc1ccc(-c2c/c(=N\c3nc4ccccc4s3)c3cc(O)ccc3o2)cc1 |
| InChI | InChI=1S/C23H16N2O3S/c1-27-16-9-6-14(7-10-16)21-13-19(17-12-15(26)8-11-20(17)28-21)25-23-24-18-4-2-3-5-22(18)29-23/h2-13,26H,1H3/b25-19+ |
| InChIKey | OKGNQTXEBSARSI-NCELDCMTSA-N |
| XLogP | 5.66 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |