C24H19N3OS — CID 6303725
N-[(E)-(6,7-dimethyl-2-phenylchromen-4-ylidene)amino]-1,3-benzothiazol-2-amine (PubChem CID 6303725) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(E)-(6,7-dimethyl-2-phenylchromen-4-ylidene)amino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-(6,7-dimethyl-2-phenylchromen-4-ylidene)amino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6303725 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[(E)-(6,7-dimethyl-2-phenylchromen-4-ylidene)amino]-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc2oc(-c3ccccc3)c/c(=N\Nc3nc4ccccc4s3)c2cc1C |
| InChI | InChI=1S/C24H19N3OS/c1-15-12-18-20(26-27-24-25-19-10-6-7-11-23(19)29-24)14-21(17-8-4-3-5-9-17)28-22(18)13-16(15)2/h3-14H,1-2H3,(H,25,27)/b26-20+ |
| InChIKey | IXVICTBFEMOGIX-LHLOQNFPSA-N |
| XLogP | 6.25 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|