C22H15N3O2S — CID 2322588
N-[(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 2322588) has the molecular formula C22H15N3O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 2322588 |
| Molecular Formula | C22H15N3O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C(=NNc1nc2ccccc2s1)C1=C(c2ccccc2)Oc2ccccc2O1 |
| InChI | InChI=1S/C22H15N3O2S/c1-2-8-15(9-3-1)21-19(26-17-11-5-6-12-18(17)27-21)14-23-25-22-24-16-10-4-7-13-20(16)28-22/h1-14H,(H,24,25) |
| InChIKey | JLLAYDHWOPMADN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|