C24H22N2O2 — CID 7730775
N-[(Z)-[2-(4-methoxyphenyl)-6,7-dimethylchromen-4-ylidene]amino]aniline (PubChem CID 7730775) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(Z)-[2-(4-methoxyphenyl)-6,7-dimethylchromen-4-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[2-(4-methoxyphenyl)-6,7-dimethylchromen-4-ylidene]amino]aniline |
|---|---|
| PubChem CID | 7730775 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[(Z)-[2-(4-methoxyphenyl)-6,7-dimethylchromen-4-ylidene]amino]aniline |
| SMILES | COc1ccc(-c2c/c(=N/Nc3ccccc3)c3cc(C)c(C)cc3o2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-16-13-21-22(26-25-19-7-5-4-6-8-19)15-23(28-24(21)14-17(16)2)18-9-11-20(27-3)12-10-18/h4-15,25H,1-3H3/b26-22- |
| InChIKey | GLWIMNYKPQSQDZ-ROMGYVFFSA-N |
| XLogP | 5.65 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|