C26H26N2O — CID 7730745
N-[(Z)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]aniline (PubChem CID 7730745) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(Z)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]aniline |
|---|---|
| PubChem CID | 7730745 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[(Z)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]aniline |
| SMILES | Cc1ccc2/c(=N\Nc3ccccc3)cc(-c3ccc(C(C)(C)C)cc3)oc2c1 |
| InChI | InChI=1S/C26H26N2O/c1-18-10-15-22-23(28-27-21-8-6-5-7-9-21)17-24(29-25(22)16-18)19-11-13-20(14-12-19)26(2,3)4/h5-17,27H,1-4H3/b28-23- |
| InChIKey | GVDIPQOOSKMADP-NFFVHWSESA-N |
| XLogP | 6.63 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|