C29H27N3O — CID 6018983
N-[(E)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]quinolin-2-amine (PubChem CID 6018983) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[(E)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]quinolin-2-amine.
| Compound Name | N-[(E)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]quinolin-2-amine |
|---|---|
| PubChem CID | 6018983 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[(E)-[2-(4-tert-butylphenyl)-7-methylchromen-4-ylidene]amino]quinolin-2-amine |
| SMILES | Cc1ccc2/c(=N/Nc3ccc4ccccc4n3)cc(-c3ccc(C(C)(C)C)cc3)oc2c1 |
| InChI | InChI=1S/C29H27N3O/c1-19-9-15-23-25(31-32-28-16-12-20-7-5-6-8-24(20)30-28)18-26(33-27(23)17-19)21-10-13-22(14-11-21)29(2,3)4/h5-18H,1-4H3,(H,30,32)/b31-25+ |
| InChIKey | SAVLGVRUYOFSHN-QCKNELIISA-N |
| XLogP | 7.18 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|