C30H30O2 — CID 102326421
2,6-bis(4-tert-butylphenyl)furo[2,3-f][1]benzofuran (PubChem CID 102326421) has the molecular formula C30H30O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2,6-bis(4-tert-butylphenyl)furo[2,3-f][1]benzofuran.
| Compound Name | 2,6-bis(4-tert-butylphenyl)furo[2,3-f][1]benzofuran |
|---|---|
| PubChem CID | 102326421 |
| Molecular Formula | C30H30O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2,6-bis(4-tert-butylphenyl)furo[2,3-f][1]benzofuran |
| SMILES | CC(C)(C)c1ccc(-c2cc3cc4oc(-c5ccc(C(C)(C)C)cc5)cc4cc3o2)cc1 |
| InChI | InChI=1S/C30H30O2/c1-29(2,3)23-11-7-19(8-12-23)25-15-21-17-28-22(18-27(21)31-25)16-26(32-28)20-9-13-24(14-10-20)30(4,5)6/h7-18H,1-6H3 |
| InChIKey | PLRIFJXMAKSHKJ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |