C28H26N3O+ — CID 135537970
N-[[2-(4-tert-butylphenyl)chromen-4-ylidene]amino]quinolin-1-ium-2-amine (PubChem CID 135537970) has the molecular formula C28H26N3O+ and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[[2-(4-tert-butylphenyl)chromen-4-ylidene]amino]quinolin-1-ium-2-amine.
| Compound Name | N-[[2-(4-tert-butylphenyl)chromen-4-ylidene]amino]quinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 135537970 |
| Molecular Formula | C28H26N3O+ |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[[2-(4-tert-butylphenyl)chromen-4-ylidene]amino]quinolin-1-ium-2-amine |
| SMILES | CC(C)(C)c1ccc(-c2cc(=NNc3ccc4ccccc4[nH+]3)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C28H25N3O/c1-28(2,3)21-15-12-20(13-16-21)26-18-24(22-9-5-7-11-25(22)32-26)30-31-27-17-14-19-8-4-6-10-23(19)29-27/h4-18H,1-3H3,(H,29,31)/p+1 |
| InChIKey | RZNVLUXQJHKZIU-UHFFFAOYSA-O |
| XLogP | 6.29 |
| TPSA | 51.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|