C22H16Cl2N2O2 — CID 7730821
N-[(Z)-[6,8-dichloro-2-(4-methoxyphenyl)chromen-4-ylidene]amino]aniline (PubChem CID 7730821) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is N-[(Z)-[6,8-dichloro-2-(4-methoxyphenyl)chromen-4-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[6,8-dichloro-2-(4-methoxyphenyl)chromen-4-ylidene]amino]aniline |
|---|---|
| PubChem CID | 7730821 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-[(Z)-[6,8-dichloro-2-(4-methoxyphenyl)chromen-4-ylidene]amino]aniline |
| SMILES | COc1ccc(-c2c/c(=N/Nc3ccccc3)c3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c1-27-17-9-7-14(8-10-17)21-13-20(26-25-16-5-3-2-4-6-16)18-11-15(23)12-19(24)22(18)28-21/h2-13,25H,1H3/b26-20- |
| InChIKey | GABLJYIDOMQZAE-QOMWVZHYSA-N |
| XLogP | 6.34 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|