C25H23N4O2+ — CID 135488716
N-[[2-(4-methoxyphenyl)-6,8-dimethylchromen-4-ylidene]amino]-1H-benzimidazol-3-ium-2-amine (PubChem CID 135488716) has the molecular formula C25H23N4O2+ and a molecular weight of 411.49 g/mol. Its IUPAC name is N-[[2-(4-methoxyphenyl)-6,8-dimethylchromen-4-ylidene]amino]-1H-benzimidazol-3-ium-2-amine.
| Compound Name | N-[[2-(4-methoxyphenyl)-6,8-dimethylchromen-4-ylidene]amino]-1H-benzimidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 135488716 |
| Molecular Formula | C25H23N4O2+ |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[[2-(4-methoxyphenyl)-6,8-dimethylchromen-4-ylidene]amino]-1H-benzimidazol-3-ium-2-amine |
| SMILES | COc1ccc(-c2cc(=NNc3[nH]c4ccccc4[nH+]3)c3cc(C)cc(C)c3o2)cc1 |
| InChI | InChI=1S/C25H22N4O2/c1-15-12-16(2)24-19(13-15)22(14-23(31-24)17-8-10-18(30-3)11-9-17)28-29-25-26-20-6-4-5-7-21(20)27-25/h4-14H,1-3H3,(H2,26,27,29)/p+1 |
| InChIKey | MWTIIVDJZFQABB-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|