C24H19Cl2NO2 — CID 20998835
N-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)-5,7-dimethylchromen-4-imine (PubChem CID 20998835) has the molecular formula C24H19Cl2NO2 and a molecular weight of 424.33 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)-5,7-dimethylchromen-4-imine.
| Compound Name | N-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)-5,7-dimethylchromen-4-imine |
|---|---|
| PubChem CID | 20998835 |
| Molecular Formula | C24H19Cl2NO2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(4-methoxyphenyl)-5,7-dimethylchromen-4-imine |
| SMILES | COc1ccc(-c2c/c(=N\c3ccc(Cl)cc3Cl)c3c(C)cc(C)cc3o2)cc1 |
| InChI | InChI=1S/C24H19Cl2NO2/c1-14-10-15(2)24-21(27-20-9-6-17(25)12-19(20)26)13-22(29-23(24)11-14)16-4-7-18(28-3)8-5-16/h4-13H,1-3H3/b27-21+ |
| InChIKey | VWPZTUWSYHRFRB-SZXQPVLSSA-N |
| XLogP | 7.26 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |