C26H21N3O5S — CID 20998891
(E)-2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(6-nitro-1,3-benzothiazol-2-yl)chromen-4-imine (PubChem CID 20998891) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is (E)-2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(6-nitro-1,3-benzothiazol-2-yl)chromen-4-imine.
| Compound Name | (E)-2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(6-nitro-1,3-benzothiazol-2-yl)chromen-4-imine |
|---|---|
| PubChem CID | 20998891 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (E)-2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-(6-nitro-1,3-benzothiazol-2-yl)chromen-4-imine |
| SMILES | COc1ccc(-c2c/c(=N\c3nc4ccc([N+](=O)[O-])cc4s3)c3c(C)cc(C)cc3o2)cc1OC |
| InChI | InChI=1S/C26H21N3O5S/c1-14-9-15(2)25-19(28-26-27-18-7-6-17(29(30)31)12-24(18)35-26)13-21(34-23(25)10-14)16-5-8-20(32-3)22(11-16)33-4/h5-13H,1-4H3/b28-19+ |
| InChIKey | GRIBYBQOWKRFGW-TURZUDJPSA-N |
| XLogP | 6.48 |
| TPSA | 99.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|