C25H21N3O3S — CID 135752356
4-[(4E)-4-(1,3-benzothiazol-2-ylhydrazinylidene)-5,7-dimethylchromen-2-yl]-2-methoxyphenol (PubChem CID 135752356) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-[(4E)-4-(1,3-benzothiazol-2-ylhydrazinylidene)-5,7-dimethylchromen-2-yl]-2-methoxyphenol.
| Compound Name | 4-[(4E)-4-(1,3-benzothiazol-2-ylhydrazinylidene)-5,7-dimethylchromen-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135752356 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-[(4E)-4-(1,3-benzothiazol-2-ylhydrazinylidene)-5,7-dimethylchromen-2-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2c/c(=N\Nc3nc4ccccc4s3)c3c(C)cc(C)cc3o2)ccc1O |
| InChI | InChI=1S/C25H21N3O3S/c1-14-10-15(2)24-18(27-28-25-26-17-6-4-5-7-23(17)32-25)13-20(31-22(24)11-14)16-8-9-19(29)21(12-16)30-3/h4-13,29H,1-3H3,(H,26,28)/b27-18+ |
| InChIKey | NPZDJOXYMHPUPA-OVVQPSECSA-N |
| XLogP | 5.97 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|