C25H23NO3 — CID 7729859
2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-phenylchromen-4-imine (PubChem CID 7729859) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-phenylchromen-4-imine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-phenylchromen-4-imine |
|---|---|
| PubChem CID | 7729859 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethyl-N-phenylchromen-4-imine |
| SMILES | COc1ccc(-c2c/c(=N\c3ccccc3)c3c(C)cc(C)cc3o2)cc1OC |
| InChI | InChI=1S/C25H23NO3/c1-16-12-17(2)25-20(26-19-8-6-5-7-9-19)15-22(29-24(25)13-16)18-10-11-21(27-3)23(14-18)28-4/h5-15H,1-4H3/b26-20+ |
| InChIKey | LKGTZFDNTURESD-LHLOQNFPSA-N |
| XLogP | 5.97 |
| TPSA | 43.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |