C18H17NO4 — CID 135821399
4-[(4E)-4-hydroxyimino-6,8-dimethylchromen-2-yl]-2-methoxyphenol (PubChem CID 135821399) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-[(4E)-4-hydroxyimino-6,8-dimethylchromen-2-yl]-2-methoxyphenol.
| Compound Name | 4-[(4E)-4-hydroxyimino-6,8-dimethylchromen-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135821399 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[(4E)-4-hydroxyimino-6,8-dimethylchromen-2-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2c/c(=N\O)c3cc(C)cc(C)c3o2)ccc1O |
| InChI | InChI=1S/C18H17NO4/c1-10-6-11(2)18-13(7-10)14(19-21)9-16(23-18)12-4-5-15(20)17(8-12)22-3/h4-9,20-21H,1-3H3/b19-14+ |
| InChIKey | XAEUUASHVOTEJI-XMHGGMMESA-N |
| XLogP | 3.72 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|