C22H18Cl2N4O3 — CID 135715907
4-[(4E)-6,8-dichloro-4-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]chromen-2-yl]-2-methoxyphenol (PubChem CID 135715907) has the molecular formula C22H18Cl2N4O3 and a molecular weight of 457.32 g/mol. Its IUPAC name is 4-[(4E)-6,8-dichloro-4-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]chromen-2-yl]-2-methoxyphenol.
| Compound Name | 4-[(4E)-6,8-dichloro-4-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]chromen-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135715907 |
| Molecular Formula | C22H18Cl2N4O3 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 4-[(4E)-6,8-dichloro-4-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]chromen-2-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2c/c(=N\Nc3nc(C)cc(C)n3)c3cc(Cl)cc(Cl)c3o2)ccc1O |
| InChI | InChI=1S/C22H18Cl2N4O3/c1-11-6-12(2)26-22(25-11)28-27-17-10-19(13-4-5-18(29)20(7-13)30-3)31-21-15(17)8-14(23)9-16(21)24/h4-10,29H,1-3H3,(H,25,26,28)/b27-17+ |
| InChIKey | MFOVNWSNDUZLHA-WPWMEQJKSA-N |
| XLogP | 5.46 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|