C16H13NO4S — CID 135008143
2-(3,4-dimethoxyphenyl)-5-nitro-1-benzothiophene (PubChem CID 135008143) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-nitro-1-benzothiophene.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-nitro-1-benzothiophene |
|---|---|
| PubChem CID | 135008143 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-nitro-1-benzothiophene |
| SMILES | COc1ccc(-c2cc3cc([N+](=O)[O-])ccc3s2)cc1OC |
| InChI | InChI=1S/C16H13NO4S/c1-20-13-5-3-10(8-14(13)21-2)16-9-11-7-12(17(18)19)4-6-15(11)22-16/h3-9H,1-2H3 |
| InChIKey | NMRRCVADSJEVIJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|