C19H17N3O5S — CID 46551108
N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 46551108) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46551108 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)CNC(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C19H17N3O5S/c1-11-3-5-15(27-2)14(7-11)21-18(23)10-20-19(24)17-9-12-8-13(22(25)26)4-6-16(12)28-17/h3-9H,10H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | UJDQXIYYZVAFII-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|