C15H12N2O4S — CID 23085740
2-(2,4-dimethoxyphenyl)-5-nitro-1,3-benzothiazole (PubChem CID 23085740) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-5-nitro-1,3-benzothiazole.
| Compound Name | 2-(2,4-dimethoxyphenyl)-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 23085740 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-5-nitro-1,3-benzothiazole |
| SMILES | COc1ccc(-c2nc3cc([N+](=O)[O-])ccc3s2)c(OC)c1 |
| InChI | InChI=1S/C15H12N2O4S/c1-20-10-4-5-11(13(8-10)21-2)15-16-12-7-9(17(18)19)3-6-14(12)22-15/h3-8H,1-2H3 |
| InChIKey | DRSCMQIEHGXMOA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|