C25H33ClN2O6 — CID 20998830
3-(diethylamino)propyl-[2-(4-methoxyphenyl)-5,7-dimethylchromen-4-ylidene]azanium perchlorate (PubChem CID 20998830) has the molecular formula C25H33ClN2O6 and a molecular weight of 493.00 g/mol. Its IUPAC name is 3-(diethylamino)propyl-[2-(4-methoxyphenyl)-5,7-dimethylchromen-4-ylidene]azanium perchlorate.
| Compound Name | 3-(diethylamino)propyl-[2-(4-methoxyphenyl)-5,7-dimethylchromen-4-ylidene]azanium perchlorate |
|---|---|
| PubChem CID | 20998830 |
| Molecular Formula | C25H33ClN2O6 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3-(diethylamino)propyl-[2-(4-methoxyphenyl)-5,7-dimethylchromen-4-ylidene]azanium perchlorate |
| SMILES | CCN(CC)CCC/[NH+]=c1\cc(-c2ccc(OC)cc2)oc2cc(C)cc(C)c12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H32N2O2.ClHO4/c1-6-27(7-2)14-8-13-26-22-17-23(20-9-11-21(28-5)12-10-20)29-24-16-18(3)15-19(4)25(22)24;2-1(3,4)5/h9-12,15-17H,6-8,13-14H2,1-5H3;(H,2,3,4,5)/b26-22+; |
| InChIKey | ZSSZUGGYLQGZIC-LIUXSCBKSA-N |
| XLogP | -1.32 |
| TPSA | 131.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|